C28H31NO5 — CID 87413472
methyl 2-[bicyclo[5.2.0]nonane-4-carbonyl(propan-2-yl)amino]-8-formyldibenzofuran-3-carboxylate (PubChem CID 87413472) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 2-[bicyclo[5.2.0]nonane-4-carbonyl(propan-2-yl)amino]-8-formyldibenzofuran-3-carboxylate.
| Compound Name | methyl 2-[bicyclo[5.2.0]nonane-4-carbonyl(propan-2-yl)amino]-8-formyldibenzofuran-3-carboxylate |
|---|---|
| PubChem CID | 87413472 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl 2-[bicyclo[5.2.0]nonane-4-carbonyl(propan-2-yl)amino]-8-formyldibenzofuran-3-carboxylate |
| SMILES | COC(=O)c1cc2oc3ccc(C=O)cc3c2cc1N(C(=O)C1CCC2CCC2CC1)C(C)C |
| InChI | InChI=1S/C28H31NO5/c1-16(2)29(27(31)20-9-7-18-5-6-19(18)8-10-20)24-13-22-21-12-17(15-30)4-11-25(21)34-26(22)14-23(24)28(32)33-3/h4,11-16,18-20H,5-10H2,1-3H3 |
| InChIKey | NUIRMNGLJCJBDH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|