C39H37F2N3O12 — CID 158445872
4-fluoro-2-nitrobenzoic acid;3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]dibenzofuran-2-carboxylic acid;methyl 4-fluoro-2-nitrobenzoate (PubChem CID 158445872) has the molecular formula C39H37F2N3O12 and a molecular weight of 777.73 g/mol. Its IUPAC name is 4-fluoro-2-nitrobenzoic acid;3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]dibenzofuran-2-carboxylic acid;methyl 4-fluoro-2-nitrobenzoate.
| Compound Name | 4-fluoro-2-nitrobenzoic acid;3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]dibenzofuran-2-carboxylic acid;methyl 4-fluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 158445872 |
| Molecular Formula | C39H37F2N3O12 |
| Molecular Weight | 777.73 g/mol |
| Exact Mass | 777.23 |
| IUPAC Name | 4-fluoro-2-nitrobenzoic acid;3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]dibenzofuran-2-carboxylic acid;methyl 4-fluoro-2-nitrobenzoate |
| SMILES | CC1CCC(C(=O)N(c2cc3oc4ccccc4c3cc2C(=O)O)C(C)C)CC1.COC(=O)c1ccc(F)cc1[N+](=O)[O-].O=C(O)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27NO4.C8H6FNO4.C7H4FNO4/c1-14(2)25(23(26)16-10-8-15(3)9-11-16)20-13-22-18(12-19(20)24(27)28)17-6-4-5-7-21(17)29-22;1-14-8(11)6-3-2-5(9)4-7(6)10(12)13;8-4-1-2-5(7(10)11)6(3-4)9(12)13/h4-7,12-16H,8-11H2,1-3H3,(H,27,28);2-4H,1H3;1-3H,(H,10,11) |
| InChIKey | HDJQXYLYTSMVAK-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 220.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.73 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|