C8H13NO4 — CID 163831656
(2R,3S)-4-cyclobutyl-2-hydroxy-3-nitrosobutanoic acid (PubChem CID 163831656) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (2R,3S)-4-cyclobutyl-2-hydroxy-3-nitrosobutanoic acid.
| Compound Name | (2R,3S)-4-cyclobutyl-2-hydroxy-3-nitrosobutanoic acid |
|---|---|
| PubChem CID | 163831656 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2R,3S)-4-cyclobutyl-2-hydroxy-3-nitrosobutanoic acid |
| SMILES | O=N[C@@H](CC1CCC1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C8H13NO4/c10-7(8(11)12)6(9-13)4-5-2-1-3-5/h5-7,10H,1-4H2,(H,11,12)/t6-,7+/m0/s1 |
| InChIKey | OEDDFVXYZPXHRR-NKWVEPMBSA-N |
| XLogP | 0.76 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |