(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid

C10H16O2 — CID 99988116

IUPAC(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid
SMILESO=C(O)[C@H](CC1CC1)C1CCC1
InChIInChI=1S/C10H16O2/c11-10(12)9(6-7-4-5-7)8-2-1-3-8/h7-9H,1-6H2,(H,11,12)/t9-/m1/s1
InChIKeyONNNPWNQTHIZRF-SECBINFHSA-N
MW168.24 g/mol
LogP2.29
Rot. Bonds4

About (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid

(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid (PubChem CID 99988116) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid
PubChem CID99988116
Molecular FormulaC10H16O2
Molecular Weight168.24 g/mol
Exact Mass168.12
IUPAC Name(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid
SMILESO=C(O)[C@H](CC1CC1)C1CCC1
InChIInChI=1S/C10H16O2/c11-10(12)9(6-7-4-5-7)8-2-1-3-8/h7-9H,1-6H2,(H,11,12)/t9-/m1/s1
InChIKeyONNNPWNQTHIZRF-SECBINFHSA-N
XLogP2.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.24
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-cyclobutyl-2-cyclopropylpropanoic acid
CID 115013430
2-cycloheptyl-3-hydroxypropanoic acid
CID 83817561
2-cycloheptylbutanoic acid
CID 79007061
3-chloro-2-cyclohexylpropanoic acid
CID 151396800
2-cyclobutylhexanoic acid
CID 102568246
(2S)-2-cyclobutylheptanoic acid
CID 99988049
CID 173256646
CID 173256646
2-cycloheptyl-4-methylpentanoic acid
CID 82928774
2-cyclopentylhept-6-enoic acid
CID 112569181
2-cyclopentyl-4-methylpent-4-enoic acid
CID 112692953
2-amino-3-cyclopropylpropanoic acid
CID 519178
2-(cyclobutylmethyl)-3-hydroxypropanoic acid
CID 130150360

Frequently Asked Questions

What is the IUPAC name of (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid?
The IUPAC name of (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid (CID 99988116) is (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid.
What is the SMILES notation for (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid?
The canonical SMILES for (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid is O=C(O)[C@H](CC1CC1)C1CCC1.
What is the InChIKey of (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid?
The InChIKey is ONNNPWNQTHIZRF-SECBINFHSA-N. The full InChI is InChI=1S/C10H16O2/c11-10(12)9(6-7-4-5-7)8-2-1-3-8/h7-9H,1-6H2,(H,11,12)/t9-/m1/s1.
What are the key properties of (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid?
(2R)-2-cyclobutyl-3-cyclopropylpropanoic acid has a molecular weight of 168.24 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclobutyl-3-cyclopropylpropanoic acid is sourced from PubChem (CID 99988116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).