C13H14N2O3 — CID 163833096
[2-(2-iminoacetyl)pyrrolidin-1-yl] benzoate (PubChem CID 163833096) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is [2-(2-iminoacetyl)pyrrolidin-1-yl] benzoate.
| Compound Name | [2-(2-iminoacetyl)pyrrolidin-1-yl] benzoate |
|---|---|
| PubChem CID | 163833096 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [2-(2-iminoacetyl)pyrrolidin-1-yl] benzoate |
| SMILES | [H]/N=C/C(=O)C1CCCN1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O3/c14-9-12(16)11-7-4-8-15(11)18-13(17)10-5-2-1-3-6-10/h1-3,5-6,9,11,14H,4,7-8H2/b14-9+ |
| InChIKey | OFJPNVHKQRRZHS-NTEUORMPSA-N |
| XLogP | 1.44 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|