C21H20N2O4 — CID 169244455
[2-(4-methoxy-1H-indole-3-carbonyl)pyrrolidin-1-yl] benzoate (PubChem CID 169244455) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is [2-(4-methoxy-1H-indole-3-carbonyl)pyrrolidin-1-yl] benzoate.
| Compound Name | [2-(4-methoxy-1H-indole-3-carbonyl)pyrrolidin-1-yl] benzoate |
|---|---|
| PubChem CID | 169244455 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [2-(4-methoxy-1H-indole-3-carbonyl)pyrrolidin-1-yl] benzoate |
| SMILES | COc1cccc2[nH]cc(C(=O)C3CCCN3OC(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C21H20N2O4/c1-26-18-11-5-9-16-19(18)15(13-22-16)20(24)17-10-6-12-23(17)27-21(25)14-7-3-2-4-8-14/h2-5,7-9,11,13,17,22H,6,10,12H2,1H3 |
| InChIKey | YMHSQRQLAQGMHE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |