C19H36N2O5 — CID 163833946
2-[2-[2-(4-methylpiperidin-1-yl)ethoxy]ethyl-[2-(oxan-2-yloxy)ethyl]amino]acetic acid (PubChem CID 163833946) has the molecular formula C19H36N2O5 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[2-[2-(4-methylpiperidin-1-yl)ethoxy]ethyl-[2-(oxan-2-yloxy)ethyl]amino]acetic acid.
| Compound Name | 2-[2-[2-(4-methylpiperidin-1-yl)ethoxy]ethyl-[2-(oxan-2-yloxy)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 163833946 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-[2-[2-(4-methylpiperidin-1-yl)ethoxy]ethyl-[2-(oxan-2-yloxy)ethyl]amino]acetic acid |
| SMILES | CC1CCN(CCOCCN(CCOC2CCCCO2)CC(=O)O)CC1 |
| InChI | InChI=1S/C19H36N2O5/c1-17-5-7-20(8-6-17)9-13-24-14-10-21(16-18(22)23)11-15-26-19-4-2-3-12-25-19/h17,19H,2-16H2,1H3,(H,22,23) |
| InChIKey | DLJREODLVQEWPZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|