C15H28N2O5 — CID 164633078
2,2-dimethoxy-1-[4-[2-[(2R)-oxan-2-yl]oxyethyl]piperazin-1-yl]ethanone (PubChem CID 164633078) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2,2-dimethoxy-1-[4-[2-[(2R)-oxan-2-yl]oxyethyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2-dimethoxy-1-[4-[2-[(2R)-oxan-2-yl]oxyethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 164633078 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2,2-dimethoxy-1-[4-[2-[(2R)-oxan-2-yl]oxyethyl]piperazin-1-yl]ethanone |
| SMILES | COC(OC)C(=O)N1CCN(CCO[C@@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C15H28N2O5/c1-19-15(20-2)14(18)17-8-6-16(7-9-17)10-12-22-13-5-3-4-11-21-13/h13,15H,3-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | YENWLXWWPGPYDC-CYBMUJFWSA-N |
| XLogP | 0.29 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|