C52H34N4O — CID 163834073
10-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-phenyl-2,3-dihydrophenanthro[9,10-d][1,3]oxazole (PubChem CID 163834073) has the molecular formula C52H34N4O and a molecular weight of 730.87 g/mol. Its IUPAC name is 10-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-phenyl-2,3-dihydrophenanthro[9,10-d][1,3]oxazole.
| Compound Name | 10-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-phenyl-2,3-dihydrophenanthro[9,10-d][1,3]oxazole |
|---|---|
| PubChem CID | 163834073 |
| Molecular Formula | C52H34N4O |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | 10-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-phenyl-2,3-dihydrophenanthro[9,10-d][1,3]oxazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccc5ccccc5c4)cc3)nc(-c3cccc(-c4ccc5c(c4)c4c(c6ccccc65)NC(c5ccccc5)O4)c3)n2)cc1 |
| InChI | InChI=1S/C52H34N4O/c1-3-13-35(14-4-1)49-54-50(36-25-22-34(23-26-36)40-27-24-33-12-7-8-17-38(33)30-40)56-51(55-49)42-19-11-18-39(31-42)41-28-29-44-43-20-9-10-21-45(43)47-48(46(44)32-41)57-52(53-47)37-15-5-2-6-16-37/h1-32,52-53H |
| InChIKey | OGEJWMCTIQUAGC-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|