C42H28N4O — CID 163658292
2-phenyl-8-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrophenanthro[9,10-d][1,3]oxazole (PubChem CID 163658292) has the molecular formula C42H28N4O and a molecular weight of 604.71 g/mol. Its IUPAC name is 2-phenyl-8-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrophenanthro[9,10-d][1,3]oxazole.
| Compound Name | 2-phenyl-8-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrophenanthro[9,10-d][1,3]oxazole |
|---|---|
| PubChem CID | 163658292 |
| Molecular Formula | C42H28N4O |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 2-phenyl-8-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrophenanthro[9,10-d][1,3]oxazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c6c(c7ccccc7c45)NC(c4ccccc4)O6)n3)cc2)cc1 |
| InChI | InChI=1S/C42H28N4O/c1-4-13-27(14-5-1)28-23-25-30(26-24-28)40-44-39(29-15-6-2-7-16-29)45-41(46-40)35-22-12-21-34-36(35)32-19-10-11-20-33(32)37-38(34)47-42(43-37)31-17-8-3-9-18-31/h1-26,42-43H |
| InChIKey | ISDOIJJPZZDXMZ-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|