C9H11BNO2S — CID 163834980
CID 163834980 (PubChem CID 163834980) has the molecular formula C9H11BNO2S and a molecular weight of 208.07 g/mol.
| Compound Name | CID 163834980 |
|---|---|
| PubChem CID | 163834980 |
| Molecular Formula | C9H11BNO2S |
| Molecular Weight | 208.07 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | — |
| SMILES | C[B]c1cnc(C(=O)O)c(SCC)c1 |
| InChI | InChI=1S/C9H11BNO2S/c1-3-14-7-4-6(10-2)5-11-8(7)9(12)13/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | PAYYDVSYNBACTE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.07 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|