C24H23F3O — CID 163836406
3-methyl-5-[3-[3-methyl-5-(trifluoromethyl)phenyl]-2-propan-2-ylphenyl]phenol (PubChem CID 163836406) has the molecular formula C24H23F3O and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-methyl-5-[3-[3-methyl-5-(trifluoromethyl)phenyl]-2-propan-2-ylphenyl]phenol.
| Compound Name | 3-methyl-5-[3-[3-methyl-5-(trifluoromethyl)phenyl]-2-propan-2-ylphenyl]phenol |
|---|---|
| PubChem CID | 163836406 |
| Molecular Formula | C24H23F3O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-methyl-5-[3-[3-methyl-5-(trifluoromethyl)phenyl]-2-propan-2-ylphenyl]phenol |
| SMILES | Cc1cc(O)cc(-c2cccc(-c3cc(C)cc(C(F)(F)F)c3)c2C(C)C)c1 |
| InChI | InChI=1S/C24H23F3O/c1-14(2)23-21(17-8-15(3)10-19(12-17)24(25,26)27)6-5-7-22(23)18-9-16(4)11-20(28)13-18/h5-14,28H,1-4H3 |
| InChIKey | OICMQQWKWUWNNI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |