About CID 163836997
CID 163836997 (PubChem CID 163836997) has the molecular formula C12H10IO-
and a molecular weight of 297.12 g/mol.
Molecular Properties
| Compound Name | CID 163836997 |
| PubChem CID | 163836997 |
| Molecular Formula | C12H10IO- |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | — |
| SMILES | CC(=O)c1ccc2c(c1)C=C[I-]C=C2 |
| InChI | InChI=1S/C12H10IO/c1-9(14)11-3-2-10-4-6-13-7-5-12(10)8-11/h2-8H,1H3/q-1 |
| InChIKey | PFPPNYUVOAQPFT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163836997 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163836997?
The IUPAC name of CID 163836997 (CID 163836997) is not available.
What is the SMILES notation for CID 163836997?
The canonical SMILES for CID 163836997 is CC(=O)c1ccc2c(c1)C=C[I-]C=C2.
What is the InChIKey of CID 163836997?
The InChIKey is PFPPNYUVOAQPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10IO/c1-9(14)11-3-2-10-4-6-13-7-5-12(10)8-11/h2-8H,1H3/q-1.
What are the key properties of CID 163836997?
CID 163836997 has a molecular weight of 297.12 g/mol, XLogP of -0.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163836997 is sourced from PubChem (CID 163836997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).