C12H20N2O — CID 163837156
N-[[(1R,5S)-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide (PubChem CID 163837156) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-[[(1R,5S)-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide.
| Compound Name | N-[[(1R,5S)-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide |
|---|---|
| PubChem CID | 163837156 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[[(1R,5S)-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)NC[C@@]12CCN[C@@H]1C2 |
| InChI | InChI=1S/C12H20N2O/c1-2-3-4-5-11(15)14-9-12-6-7-13-10(12)8-12/h2,10,13H,1,3-9H2,(H,14,15)/t10-,12+/m1/s1 |
| InChIKey | OITGLLJFSOWIPA-PWSUYJOCSA-N |
| XLogP | 1.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|