C19H36N2O — CID 142347399
1-(2,8-diazaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-1-one;pent-1-ene (PubChem CID 142347399) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-(2,8-diazaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-1-one;pent-1-ene.
| Compound Name | 1-(2,8-diazaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-1-one;pent-1-ene |
|---|---|
| PubChem CID | 142347399 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 1-(2,8-diazaspiro[4.5]decan-8-yl)-3,3-dimethylbutan-1-one;pent-1-ene |
| SMILES | C=CCCC.CC(C)(C)CC(=O)N1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C14H26N2O.C5H10/c1-13(2,3)10-12(17)16-8-5-14(6-9-16)4-7-15-11-14;1-3-5-4-2/h15H,4-11H2,1-3H3;3H,1,4-5H2,2H3 |
| InChIKey | BXUSWOQHCYHWDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|