C17H30N2O — CID 56702288
[1-(2,2-dimethylpent-4-enyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 56702288) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is [1-(2,2-dimethylpent-4-enyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(2,2-dimethylpent-4-enyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 56702288 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | [1-(2,2-dimethylpent-4-enyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CCC(C)(C)CN1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H30N2O/c1-4-9-17(2,3)14-18-12-7-15(8-13-18)16(20)19-10-5-6-11-19/h4,15H,1,5-14H2,2-3H3 |
| InChIKey | KNNKDVQNYSFVCE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|