C13H22N2O — CID 50973673
1-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)but-3-en-1-one (PubChem CID 50973673) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)but-3-en-1-one.
| Compound Name | 1-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)but-3-en-1-one |
|---|---|
| PubChem CID | 50973673 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)but-3-en-1-one |
| SMILES | C=CCC(=O)N1CCC2(CCN(C)C2)CC1 |
| InChI | InChI=1S/C13H22N2O/c1-3-4-12(16)15-9-6-13(7-10-15)5-8-14(2)11-13/h3H,1,4-11H2,2H3 |
| InChIKey | SGEQUVQEZFBYHC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|