C18H36O6 — CID 163839559
(1S,2R,4R,5R)-3,6-bis(2-methylpentoxy)cyclohexane-1,2,4,5-tetrol (PubChem CID 163839559) has the molecular formula C18H36O6 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1S,2R,4R,5R)-3,6-bis(2-methylpentoxy)cyclohexane-1,2,4,5-tetrol.
| Compound Name | (1S,2R,4R,5R)-3,6-bis(2-methylpentoxy)cyclohexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 163839559 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1S,2R,4R,5R)-3,6-bis(2-methylpentoxy)cyclohexane-1,2,4,5-tetrol |
| SMILES | CCCC(C)COC1[C@@H](O)[C@@H](O)C(OCC(C)CCC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H36O6/c1-5-7-11(3)9-23-17-13(19)15(21)18(16(22)14(17)20)24-10-12(4)8-6-2/h11-22H,5-10H2,1-4H3/t11?,12?,13-,14-,15-,16+,17?,18?/m1/s1 |
| InChIKey | OKTHYXQTPAGDNN-IGTPPDAPSA-N |
| XLogP | 1.09 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |