About N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide
N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 163840242) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide |
| PubChem CID | 163840242 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC=CC(=[N+]=[N-])C1 |
| InChI | InChI=1S/C8H9N3O/c1-6(12)10-7-3-2-4-8(5-7)11-9/h2-4H,5H2,1H3,(H,10,12) |
| InChIKey | OLIKWYUHJLRKSO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide?
The IUPAC name of N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide (CID 163840242) is N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide.
What is the SMILES notation for N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide?
The canonical SMILES for N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide is CC(=O)NC1=CC=CC(=[N+]=[N-])C1.
What is the InChIKey of N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide?
The InChIKey is OLIKWYUHJLRKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-6(12)10-7-3-2-4-8(5-7)11-9/h2-4H,5H2,1H3,(H,10,12).
What are the key properties of N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide?
N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide has a molecular weight of 163.18 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide is sourced from PubChem (CID 163840242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).