C8H9N3O — CID 163840242
N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 163840242) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide.
| Compound Name | N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 163840242 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | N-(5-diazocyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC=CC(=[N+]=[N-])C1 |
| InChI | InChI=1S/C8H9N3O/c1-6(12)10-7-3-2-4-8(5-7)11-9/h2-4H,5H2,1H3,(H,10,12) |
| InChIKey | OLIKWYUHJLRKSO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|