C23H36N6O2 — CID 163840540
(3S)-1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanimidoyl]-N-[(1R)-1-(3-ethenylphenyl)ethyl]diazinane-3-carboxamide (PubChem CID 163840540) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is (3S)-1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanimidoyl]-N-[(1R)-1-(3-ethenylphenyl)ethyl]diazinane-3-carboxamide.
| Compound Name | (3S)-1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanimidoyl]-N-[(1R)-1-(3-ethenylphenyl)ethyl]diazinane-3-carboxamide |
|---|---|
| PubChem CID | 163840540 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (3S)-1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanimidoyl]-N-[(1R)-1-(3-ethenylphenyl)ethyl]diazinane-3-carboxamide |
| SMILES | [H]/N=C(\C(C)NC(=O)[C@@H](N)C(C)C)N1CCC[C@@H](C(=O)N[C@H](C)c2cccc(C=C)c2)N1 |
| InChI | InChI=1S/C23H36N6O2/c1-6-17-9-7-10-18(13-17)15(4)26-22(30)19-11-8-12-29(28-19)21(25)16(5)27-23(31)20(24)14(2)3/h6-7,9-10,13-16,19-20,25,28H,1,8,11-12,24H2,2-5H3,(H,26,30)(H,27,31)/b25-21+/t15-,16?,19+,20+/m1/s1 |
| InChIKey | OLPIOUMSKRFPQE-MMKROPKOSA-N |
| XLogP | 1.94 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|