C7H10N2O — CID 163844316
N-cyano-2,3-dimethylcyclopropane-1-carboxamide (PubChem CID 163844316) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is N-cyano-2,3-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-cyano-2,3-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163844316 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-cyano-2,3-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1C(C)C1C(=O)NC#N |
| InChI | InChI=1S/C7H10N2O/c1-4-5(2)6(4)7(10)9-3-8/h4-6H,1-2H3,(H,9,10) |
| InChIKey | OOUAONZPGZACRX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|