About N-cyanopentanamide
N-cyanopentanamide (PubChem CID 57250959) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is N-cyanopentanamide.
Molecular Properties
| Compound Name | N-cyanopentanamide |
| PubChem CID | 57250959 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | N-cyanopentanamide |
| SMILES | CCCCC(=O)NC#N |
| InChI | InChI=1S/C6H10N2O/c1-2-3-4-6(9)8-5-7/h2-4H2,1H3,(H,8,9) |
| InChIKey | XMHRDISBPYNHFW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyanopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyanopentanamide?
The IUPAC name of N-cyanopentanamide (CID 57250959) is N-cyanopentanamide.
What is the SMILES notation for N-cyanopentanamide?
The canonical SMILES for N-cyanopentanamide is CCCCC(=O)NC#N.
What is the InChIKey of N-cyanopentanamide?
The InChIKey is XMHRDISBPYNHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-2-3-4-6(9)8-5-7/h2-4H2,1H3,(H,8,9).
What are the key properties of N-cyanopentanamide?
N-cyanopentanamide has a molecular weight of 126.16 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyanopentanamide is sourced from PubChem (CID 57250959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).