About N-cyanohexanamide
N-cyanohexanamide (PubChem CID 15100145) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is N-cyanohexanamide.
Molecular Properties
| Compound Name | N-cyanohexanamide |
| PubChem CID | 15100145 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N-cyanohexanamide |
| SMILES | CCCCCC(=O)NC#N |
| InChI | InChI=1S/C7H12N2O/c1-2-3-4-5-7(10)9-6-8/h2-5H2,1H3,(H,9,10) |
| InChIKey | RMPBUKXOEJMRRN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyanohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyanohexanamide?
The IUPAC name of N-cyanohexanamide (CID 15100145) is N-cyanohexanamide.
What is the SMILES notation for N-cyanohexanamide?
The canonical SMILES for N-cyanohexanamide is CCCCCC(=O)NC#N.
What is the InChIKey of N-cyanohexanamide?
The InChIKey is RMPBUKXOEJMRRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-2-3-4-5-7(10)9-6-8/h2-5H2,1H3,(H,9,10).
What are the key properties of N-cyanohexanamide?
N-cyanohexanamide has a molecular weight of 140.19 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyanohexanamide is sourced from PubChem (CID 15100145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).