C12H15BBrNO — CID 163846393
CID 163846393 (PubChem CID 163846393) has the molecular formula C12H15BBrNO and a molecular weight of 279.97 g/mol.
| Compound Name | CID 163846393 |
|---|---|
| PubChem CID | 163846393 |
| Molecular Formula | C12H15BBrNO |
| Molecular Weight | 279.97 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | — |
| SMILES | [B]CCC(Br)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C12H15BBrNO/c1-9-2-4-10(5-3-9)8-15-12(16)11(14)6-7-13/h2-5,11H,6-8H2,1H3,(H,15,16) |
| InChIKey | QAMODYPOCRINLN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|