C17H19NO2 — CID 6543594
(2R)-2-methoxy-N-[(4-methylphenyl)methyl]-2-phenylacetamide (PubChem CID 6543594) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[(4-methylphenyl)methyl]-2-phenylacetamide.
| Compound Name | (2R)-2-methoxy-N-[(4-methylphenyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 6543594 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2R)-2-methoxy-N-[(4-methylphenyl)methyl]-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)NCc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-13-8-10-14(11-9-13)12-18-17(19)16(20-2)15-6-4-3-5-7-15/h3-11,16H,12H2,1-2H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | NQPGYBJMHYTASA-MRXNPFEDSA-N |
| XLogP | 3.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |