C21H23N5O5 — CID 24882521
(3S)-4-azido-3-[[4-[[(2-methoxy-2-phenylacetyl)amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882521) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[(2-methoxy-2-phenylacetyl)amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[(2-methoxy-2-phenylacetyl)amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882521 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[(2-methoxy-2-phenylacetyl)amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | COC(C(=O)NCc1ccc(C(=O)N[C@H](CN=[N+]=[N-])CC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N5O5/c1-31-19(15-5-3-2-4-6-15)21(30)23-12-14-7-9-16(10-8-14)20(29)25-17(11-18(27)28)13-24-26-22/h2-10,17,19H,11-13H2,1H3,(H,23,30)(H,25,29)(H,27,28)/t17-,19?/m0/s1 |
| InChIKey | LYMTXTCMFRDSMU-KKFHFHRHSA-N |
| XLogP | 2.57 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|