C21H22FN5O4 — CID 24882459
(3S)-4-azido-3-[[4-[[3-(4-fluorophenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882459) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[3-(4-fluorophenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[3-(4-fluorophenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882459 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[3-(4-fluorophenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid |
| SMILES | [N-]=[N+]=NC[C@H](CC(=O)O)NC(=O)c1ccc(CNC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H22FN5O4/c22-17-8-3-14(4-9-17)5-10-19(28)24-12-15-1-6-16(7-2-15)21(31)26-18(11-20(29)30)13-25-27-23/h1-4,6-9,18H,5,10-13H2,(H,24,28)(H,26,31)(H,29,30)/t18-/m0/s1 |
| InChIKey | JIGDTDBDMXPVDK-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|