C19H17ClFN5O7S — CID 24882671
5-[[4-[[(2S)-1-azido-3-carboxypropan-2-yl]carbamoyl]phenyl]methylsulfamoyl]-2-chloro-4-fluorobenzoic acid (PubChem CID 24882671) has the molecular formula C19H17ClFN5O7S and a molecular weight of 513.89 g/mol. Its IUPAC name is 5-[[4-[[(2S)-1-azido-3-carboxypropan-2-yl]carbamoyl]phenyl]methylsulfamoyl]-2-chloro-4-fluorobenzoic acid.
| Compound Name | 5-[[4-[[(2S)-1-azido-3-carboxypropan-2-yl]carbamoyl]phenyl]methylsulfamoyl]-2-chloro-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 24882671 |
| Molecular Formula | C19H17ClFN5O7S |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 5-[[4-[[(2S)-1-azido-3-carboxypropan-2-yl]carbamoyl]phenyl]methylsulfamoyl]-2-chloro-4-fluorobenzoic acid |
| SMILES | [N-]=[N+]=NC[C@H](CC(=O)O)NC(=O)c1ccc(CNS(=O)(=O)c2cc(C(=O)O)c(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H17ClFN5O7S/c20-14-7-15(21)16(6-13(14)19(30)31)34(32,33)24-8-10-1-3-11(4-2-10)18(29)25-12(5-17(27)28)9-23-26-22/h1-4,6-7,12,24H,5,8-9H2,(H,25,29)(H,27,28)(H,30,31)/t12-/m0/s1 |
| InChIKey | QSBKKHSIMBZWPK-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 198.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|