C20H20FN5O4 — CID 24882313
(3S)-4-azido-3-[[4-[[(4-fluoro-3-methylbenzoyl)amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882313) has the molecular formula C20H20FN5O4 and a molecular weight of 413.41 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[(4-fluoro-3-methylbenzoyl)amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[(4-fluoro-3-methylbenzoyl)amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882313 |
| Molecular Formula | C20H20FN5O4 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[(4-fluoro-3-methylbenzoyl)amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | Cc1cc(C(=O)NCc2ccc(C(=O)N[C@H](CN=[N+]=[N-])CC(=O)O)cc2)ccc1F |
| InChI | InChI=1S/C20H20FN5O4/c1-12-8-15(6-7-17(12)21)19(29)23-10-13-2-4-14(5-3-13)20(30)25-16(9-18(27)28)11-24-26-22/h2-8,16H,9-11H2,1H3,(H,23,29)(H,25,30)(H,27,28)/t16-/m0/s1 |
| InChIKey | LKXNRHPRVGGWDR-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|