C22H27N5O5S — CID 24882674
(3S)-4-azido-3-[[4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882674) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882674 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoyl]amino]butanoic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCc2ccc(C(=O)N[C@H](CN=[N+]=[N-])CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H27N5O5S/c1-22(2,3)17-8-10-19(11-9-17)33(31,32)25-13-15-4-6-16(7-5-15)21(30)26-18(12-20(28)29)14-24-27-23/h4-11,18,25H,12-14H2,1-3H3,(H,26,30)(H,28,29)/t18-/m0/s1 |
| InChIKey | WMXJSUOOZYQURN-SFHVURJKSA-N |
| XLogP | 3.35 |
| TPSA | 161.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|