C21H23N5O6 — CID 24882627
(3S)-4-azido-3-[[4-[[(2,4-dimethoxybenzoyl)amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882627) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[(2,4-dimethoxybenzoyl)amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[(2,4-dimethoxybenzoyl)amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882627 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[(2,4-dimethoxybenzoyl)amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | COc1ccc(C(=O)NCc2ccc(C(=O)N[C@H](CN=[N+]=[N-])CC(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H23N5O6/c1-31-16-7-8-17(18(10-16)32-2)21(30)23-11-13-3-5-14(6-4-13)20(29)25-15(9-19(27)28)12-24-26-22/h3-8,10,15H,9,11-12H2,1-2H3,(H,23,30)(H,25,29)(H,27,28)/t15-/m0/s1 |
| InChIKey | NTNXBTWSZPNOPB-HNNXBMFYSA-N |
| XLogP | 2.52 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|