C20H17F4N5O4 — CID 24882287
(3S)-4-azido-3-[[4-[[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882287) has the molecular formula C20H17F4N5O4 and a molecular weight of 467.38 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882287 |
| Molecular Formula | C20H17F4N5O4 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | [N-]=[N+]=NC[C@H](CC(=O)O)NC(=O)c1ccc(CNC(=O)c2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H17F4N5O4/c21-16-6-5-13(7-15(16)20(22,23)24)18(32)26-9-11-1-3-12(4-2-11)19(33)28-14(8-17(30)31)10-27-29-25/h1-7,14H,8-10H2,(H,26,32)(H,28,33)(H,30,31)/t14-/m0/s1 |
| InChIKey | OYAHONSKRYUBSO-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|