C20H21N5O5 — CID 24882602
(3S)-4-azido-3-[[4-[[[2-(3-hydroxyphenyl)acetyl]amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882602) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[[2-(3-hydroxyphenyl)acetyl]amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[[2-(3-hydroxyphenyl)acetyl]amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882602 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[[2-(3-hydroxyphenyl)acetyl]amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | [N-]=[N+]=NC[C@H](CC(=O)O)NC(=O)c1ccc(CNC(=O)Cc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C20H21N5O5/c21-25-23-12-16(10-19(28)29)24-20(30)15-6-4-13(5-7-15)11-22-18(27)9-14-2-1-3-17(26)8-14/h1-8,16,26H,9-12H2,(H,22,27)(H,24,30)(H,28,29)/t16-/m0/s1 |
| InChIKey | JAUCATOEINKELN-INIZCTEOSA-N |
| XLogP | 2.13 |
| TPSA | 164.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|