C23H27N5O6 — CID 24882490
(3S)-4-azido-3-[[4-[[3-(3,4-dimethoxyphenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882490) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[3-(3,4-dimethoxyphenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[3-(3,4-dimethoxyphenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882490 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[3-(3,4-dimethoxyphenyl)propanoylamino]methyl]benzoyl]amino]butanoic acid |
| SMILES | COc1ccc(CCC(=O)NCc2ccc(C(=O)N[C@H](CN=[N+]=[N-])CC(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C23H27N5O6/c1-33-19-9-5-15(11-20(19)34-2)6-10-21(29)25-13-16-3-7-17(8-4-16)23(32)27-18(12-22(30)31)14-26-28-24/h3-5,7-9,11,18H,6,10,12-14H2,1-2H3,(H,25,29)(H,27,32)(H,30,31)/t18-/m0/s1 |
| InChIKey | YYHPKEYPYYJLJK-SFHVURJKSA-N |
| XLogP | 2.84 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|