C20H20ClN5O5 — CID 24882574
(3S)-4-azido-3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]benzoyl]amino]butanoic acid (PubChem CID 24882574) has the molecular formula C20H20ClN5O5 and a molecular weight of 445.86 g/mol. Its IUPAC name is (3S)-4-azido-3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]benzoyl]amino]butanoic acid.
| Compound Name | (3S)-4-azido-3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24882574 |
| Molecular Formula | C20H20ClN5O5 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (3S)-4-azido-3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]benzoyl]amino]butanoic acid |
| SMILES | [N-]=[N+]=NC[C@H](CC(=O)O)NC(=O)c1ccc(CNC(=O)COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN5O5/c21-15-5-7-17(8-6-15)31-12-18(27)23-10-13-1-3-14(4-2-13)20(30)25-16(9-19(28)29)11-24-26-22/h1-8,16H,9-12H2,(H,23,27)(H,25,30)(H,28,29)/t16-/m0/s1 |
| InChIKey | HLARSVRQOBPIDX-INIZCTEOSA-N |
| XLogP | 2.92 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|