C21H17FN4O6 — CID 163850124
7-fluoro-6-[3-(furan-2-carbonylimino)pyrrolidin-1-yl]-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 163850124) has the molecular formula C21H17FN4O6 and a molecular weight of 440.39 g/mol. Its IUPAC name is 7-fluoro-6-[3-(furan-2-carbonylimino)pyrrolidin-1-yl]-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | 7-fluoro-6-[3-(furan-2-carbonylimino)pyrrolidin-1-yl]-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 163850124 |
| Molecular Formula | C21H17FN4O6 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 7-fluoro-6-[3-(furan-2-carbonylimino)pyrrolidin-1-yl]-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | CN1COc2c(N3CC/C(=N\C(=O)c4ccco4)C3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C21H17FN4O6/c1-24-10-32-19-16-12(18(27)13(21(29)30)9-26(16)24)7-14(22)17(19)25-5-4-11(8-25)23-20(28)15-3-2-6-31-15/h2-3,6-7,9H,4-5,8,10H2,1H3,(H,29,30)/b23-11+ |
| InChIKey | OTQRGVASHZKZPB-FOKLQQMPSA-N |
| XLogP | 1.84 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|