C17H17FN4O5 — CID 74950864
7-fluoro-6-(3-methoxyiminopyrrolidin-1-yl)-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 74950864) has the molecular formula C17H17FN4O5 and a molecular weight of 376.34 g/mol. Its IUPAC name is 7-fluoro-6-(3-methoxyiminopyrrolidin-1-yl)-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | 7-fluoro-6-(3-methoxyiminopyrrolidin-1-yl)-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 74950864 |
| Molecular Formula | C17H17FN4O5 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 7-fluoro-6-(3-methoxyiminopyrrolidin-1-yl)-2-methyl-10-oxo-4-oxa-1,2-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | CON=C1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2OCN4C)C1 |
| InChI | InChI=1S/C17H17FN4O5/c1-20-8-27-16-13-10(15(23)11(17(24)25)7-22(13)20)5-12(18)14(16)21-4-3-9(6-21)19-26-2/h5,7H,3-4,6,8H2,1-2H3,(H,24,25) |
| InChIKey | PYPWURPMXBOVPT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|