C24H39NO4 — CID 163851829
ethyl 2-(2,7-dimethylocta-2,7-dienyl)-4,9-dimethyl-2-nitrodeca-4,9-dienoate (PubChem CID 163851829) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is ethyl 2-(2,7-dimethylocta-2,7-dienyl)-4,9-dimethyl-2-nitrodeca-4,9-dienoate.
| Compound Name | ethyl 2-(2,7-dimethylocta-2,7-dienyl)-4,9-dimethyl-2-nitrodeca-4,9-dienoate |
|---|---|
| PubChem CID | 163851829 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | ethyl 2-(2,7-dimethylocta-2,7-dienyl)-4,9-dimethyl-2-nitrodeca-4,9-dienoate |
| SMILES | C=C(C)CCCC=C(C)CC(CC(C)=CCCCC(=C)C)(C(=O)OCC)[N+](=O)[O-] |
| InChI | InChI=1S/C24H39NO4/c1-8-29-23(26)24(25(27)28,17-21(6)15-11-9-13-19(2)3)18-22(7)16-12-10-14-20(4)5/h15-16H,2,4,8-14,17-18H2,1,3,5-7H3 |
| InChIKey | OVADLESRWMDLPO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|