C12H17NO4 — CID 102173572
prop-2-enyl 3,4-dimethyl-1-nitrocyclohex-3-ene-1-carboxylate (PubChem CID 102173572) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is prop-2-enyl 3,4-dimethyl-1-nitrocyclohex-3-ene-1-carboxylate.
| Compound Name | prop-2-enyl 3,4-dimethyl-1-nitrocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102173572 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | prop-2-enyl 3,4-dimethyl-1-nitrocyclohex-3-ene-1-carboxylate |
| SMILES | C=CCOC(=O)C1([N+](=O)[O-])CCC(C)=C(C)C1 |
| InChI | InChI=1S/C12H17NO4/c1-4-7-17-11(14)12(13(15)16)6-5-9(2)10(3)8-12/h4H,1,5-8H2,2-3H3 |
| InChIKey | CTPXBSYTPXFLNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|