C11H17NO3 — CID 155131391
prop-2-enyl 1,3-dimethyl-2-oxopiperidine-3-carboxylate (PubChem CID 155131391) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is prop-2-enyl 1,3-dimethyl-2-oxopiperidine-3-carboxylate.
| Compound Name | prop-2-enyl 1,3-dimethyl-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 155131391 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | prop-2-enyl 1,3-dimethyl-2-oxopiperidine-3-carboxylate |
| SMILES | C=CCOC(=O)C1(C)CCCN(C)C1=O |
| InChI | InChI=1S/C11H17NO3/c1-4-8-15-10(14)11(2)6-5-7-12(3)9(11)13/h4H,1,5-8H2,2-3H3 |
| InChIKey | DSALPDWUBUZEMI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|