C13H17F3O3 — CID 15530329
ethyl 3,4-dimethyl-1-(2,2,2-trifluoroacetyl)cyclohex-3-ene-1-carboxylate (PubChem CID 15530329) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is ethyl 3,4-dimethyl-1-(2,2,2-trifluoroacetyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 3,4-dimethyl-1-(2,2,2-trifluoroacetyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15530329 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl 3,4-dimethyl-1-(2,2,2-trifluoroacetyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)C(F)(F)F)CCC(C)=C(C)C1 |
| InChI | InChI=1S/C13H17F3O3/c1-4-19-11(18)12(10(17)13(14,15)16)6-5-8(2)9(3)7-12/h4-7H2,1-3H3 |
| InChIKey | YIVZHZMSIWSFEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|