C13H15F3N2O3 — CID 163852937
N-(2,3-dimethylphenyl)-4,4,4-trifluoro-3-(nitromethyl)butanamide (PubChem CID 163852937) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4,4,4-trifluoro-3-(nitromethyl)butanamide.
| Compound Name | N-(2,3-dimethylphenyl)-4,4,4-trifluoro-3-(nitromethyl)butanamide |
|---|---|
| PubChem CID | 163852937 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4,4,4-trifluoro-3-(nitromethyl)butanamide |
| SMILES | Cc1cccc(NC(=O)CC(C[N+](=O)[O-])C(F)(F)F)c1C |
| InChI | InChI=1S/C13H15F3N2O3/c1-8-4-3-5-11(9(8)2)17-12(19)6-10(7-18(20)21)13(14,15)16/h3-5,10H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | OVXMKPLNRZTACK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|