C34H38IN2O3- — CID 163854764
CID 163854764 (PubChem CID 163854764) has the molecular formula C34H38IN2O3- and a molecular weight of 649.59 g/mol.
| Compound Name | CID 163854764 |
|---|---|
| PubChem CID | 163854764 |
| Molecular Formula | C34H38IN2O3- |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | — |
| SMILES | CCc1ccc(C2(C(=O)N3CCCC(Oc4ccc(C5C[I-]5)cc4)(C(=O)NCCc4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C34H38IN2O3/c1-2-25-9-13-28(14-10-25)33(19-20-33)32(39)37-22-6-18-34(24-37,31(38)36-21-17-26-7-4-3-5-8-26)40-29-15-11-27(12-16-29)30-23-35-30/h3-5,7-16,30H,2,6,17-24H2,1H3,(H,36,38)/q-1 |
| InChIKey | XBDWWBNCLLRFHV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|