C31H36N2O3 — CID 23600727
benzyl 4-[2-[2-(4-ethylphenyl)ethylamino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 23600727) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is benzyl 4-[2-[2-(4-ethylphenyl)ethylamino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-[2-(4-ethylphenyl)ethylamino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 23600727 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | benzyl 4-[2-[2-(4-ethylphenyl)ethylamino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CCc1ccc(CCNC(=O)CC2(c3ccccc3)CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H36N2O3/c1-2-25-13-15-26(16-14-25)17-20-32-29(34)23-31(28-11-7-4-8-12-28)18-21-33(22-19-31)30(35)36-24-27-9-5-3-6-10-27/h3-16H,2,17-24H2,1H3,(H,32,34) |
| InChIKey | AKPJKOASMZIEHZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |