C32H40N2O3 — CID 142821287
benzyl 4-(2-oxopropyl)-4-phenylpiperidine-1-carboxylate;4-[(2R)-2-methylbutyl]pyridine (PubChem CID 142821287) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is benzyl 4-(2-oxopropyl)-4-phenylpiperidine-1-carboxylate;4-[(2R)-2-methylbutyl]pyridine.
| Compound Name | benzyl 4-(2-oxopropyl)-4-phenylpiperidine-1-carboxylate;4-[(2R)-2-methylbutyl]pyridine |
|---|---|
| PubChem CID | 142821287 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | benzyl 4-(2-oxopropyl)-4-phenylpiperidine-1-carboxylate;4-[(2R)-2-methylbutyl]pyridine |
| SMILES | CC(=O)CC1(c2ccccc2)CCN(C(=O)OCc2ccccc2)CC1.CC[C@@H](C)Cc1ccncc1 |
| InChI | InChI=1S/C22H25NO3.C10H15N/c1-18(24)16-22(20-10-6-3-7-11-20)12-14-23(15-13-22)21(25)26-17-19-8-4-2-5-9-19;1-3-9(2)8-10-4-6-11-7-5-10/h2-11H,12-17H2,1H3;4-7,9H,3,8H2,1-2H3/t;9-/m.1/s1 |
| InChIKey | LAHANMUSBLFLIK-YYVQYPFISA-N |
| XLogP | 7.01 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |