C26H28N2O3S — CID 23600714
benzyl 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 23600714) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is benzyl 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 23600714 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | benzyl 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | O=C(CC1(c2ccccc2)CCN(C(=O)OCc2ccccc2)CC1)NCc1cccs1 |
| InChI | InChI=1S/C26H28N2O3S/c29-24(27-19-23-12-7-17-32-23)18-26(22-10-5-2-6-11-22)13-15-28(16-14-26)25(30)31-20-21-8-3-1-4-9-21/h1-12,17H,13-16,18-20H2,(H,27,29) |
| InChIKey | WMKQAJJMUGRETG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |