C30H34N2O5 — CID 87392921
benzyl 4-[2-[methoxy-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 87392921) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is benzyl 4-[2-[methoxy-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-[methoxy-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87392921 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | benzyl 4-[2-[methoxy-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | COc1ccc(CN(OC)C(=O)CC2(c3ccccc3)CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H34N2O5/c1-35-27-15-13-24(14-16-27)22-32(36-2)28(33)21-30(26-11-7-4-8-12-26)17-19-31(20-18-30)29(34)37-23-25-9-5-3-6-10-25/h3-16H,17-23H2,1-2H3 |
| InChIKey | ZIVITVWBJLEFLM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|