C26H34N2O5S — CID 139746790
benzyl 4-(4-methoxyphenyl)sulfanyl-4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 139746790) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is benzyl 4-(4-methoxyphenyl)sulfanyl-4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-(4-methoxyphenyl)sulfanyl-4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139746790 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | benzyl 4-(4-methoxyphenyl)sulfanyl-4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(SC2(CC(=O)NOC(C)(C)C)CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O5S/c1-25(2,3)33-27-23(29)18-26(34-22-12-10-21(31-4)11-13-22)14-16-28(17-15-26)24(30)32-19-20-8-6-5-7-9-20/h5-13H,14-19H2,1-4H3,(H,27,29) |
| InChIKey | PJGOTXKZHGSKBB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|