C20H14ClFIN4O4- — CID 163855325
CID 163855325 (PubChem CID 163855325) has the molecular formula C20H14ClFIN4O4- and a molecular weight of 555.71 g/mol.
| Compound Name | CID 163855325 |
|---|---|
| PubChem CID | 163855325 |
| Molecular Formula | C20H14ClFIN4O4- |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | — |
| SMILES | ON=C(C1=N[I-]CCO1)c1ccccc1Oc1ncnc(Oc2ccccc2Cl)c1F |
| InChI | InChI=1S/C20H14ClFIN4O4/c21-13-6-2-4-8-15(13)31-19-16(22)18(24-11-25-19)30-14-7-3-1-5-12(14)17(27-28)20-26-23-9-10-29-20/h1-8,11,28H,9-10H2/q-1 |
| InChIKey | NGCQZPHBTUAPMP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|