C21H14ClFN4O5 — CID 149338900
N-[[2-[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-(5,6-dihydro-1,4,2-dioxazin-3-yl)methylidene]formamide (PubChem CID 149338900) has the molecular formula C21H14ClFN4O5 and a molecular weight of 456.82 g/mol. Its IUPAC name is N-[[2-[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-(5,6-dihydro-1,4,2-dioxazin-3-yl)methylidene]formamide.
| Compound Name | N-[[2-[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-(5,6-dihydro-1,4,2-dioxazin-3-yl)methylidene]formamide |
|---|---|
| PubChem CID | 149338900 |
| Molecular Formula | C21H14ClFN4O5 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | N-[[2-[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-(5,6-dihydro-1,4,2-dioxazin-3-yl)methylidene]formamide |
| SMILES | O=C/N=C(\C1=NOCCO1)c1ccccc1Oc1ncnc(Oc2ccccc2Cl)c1F |
| InChI | InChI=1S/C21H14ClFN4O5/c22-14-6-2-4-8-16(14)32-20-17(23)19(24-11-25-20)31-15-7-3-1-5-13(15)18(26-12-28)21-27-30-10-9-29-21/h1-8,11-12H,9-10H2/b26-18- |
| InChIKey | YDUCHDICOGIRNV-ITYLOYPMSA-N |
| XLogP | 4.16 |
| TPSA | 104.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|